| ID | C0005 |
| Compound name | β-Fructose-6-phosphate |
| Stereochemistry | β-D-Fructose-6-phosphate |
| Aracyc name | D-Fructose-6-phosphate |
| External link |
|
| Mass information |
1st experiment : CE-TOF/MS (Anion analysis), GC-TOF/MS 2nd experiment : CE-TOF/MS (Anion analysis) |
| Molecular Formula | H11P1C6O9 |
| Canonical SMILES | C(C1(C(C(C(O1)(CO)O)O)O))OP([O-])([O-])=O |
| Molecular Weight | 260.137 |
| Pathway Information | starch biosynthesis, Rubisco shunt, Calvin-Benson-Bassham cycle, mannitol degradation II, ascorbate biosynthesis I (L-galactose pathway), UDP-N-acetyl-D-glucosamine biosynthesis II, GDP-mannose biosynthesis, mannose degradation, sucrose biosynthesis I, sucrose degradation III, glycolysis IV (plant cytosol), pentose phosphate pathway (non-oxidative branch), glycolysis I, superpathway of sucrose and starch metabolism II (photosynthetic tissue), D-mannose degradation, gluconeogenesis I |
| CAS ID | 643-13-0 |
| Synonym | D-fructose-6-phosphate; F6P; fructose-6P; fructose-6-P; fruc6p; fru-6-P; fructose-6-phosphate; A-D-fructose-6-P; D-fructose-6-Pβ-D-fructofuranose 6-phosphate; D-fructofuranose 6-phosphate |
| External ID | PUBCHEM:21604863, KNAPSACK:C00007305, CHEBI:57634, LIGAND-CPD:C00085, KNAPSACK:C00007305 |