| ID | C0110  |
| Compound name | Guanosine |
| Stereochemistry | - |
| Aracyc name | Guanosine |
| External link |
 http://pmn.plantcyc.org/ARA/NEW-IMAGE?type=COMPOUND&object=GUANOSINE
|
| Mass information |
1st experiment : CE-TOF/MS (Cation analysis) 2nd experiment : |
| Molecular Formula | H13O5N5C10 |
| Canonical SMILES | C2(N(C1(C(O)C(O)C(CO)O1))C3(=C(N=2)C(NC(N)=N3)=O)) |
| Molecular Weight | 283.243 |
| Pathway Information | guanosine nucleotides degradation I, guanine and guanosine salvage II, guanosine nucleotides degradation II, guanine and guanosine salvage III |
| CAS ID | 118-00-3 |
| Synonym | nucleoside Q |
| External ID | CHEBI:16750, PUBCHEM:6802, LIGAND-CPD:C00387 |
information