| ID | C0244  |
| Compound name | Sucrose |
| Stereochemistry | D-Sucrose |
| Aracyc name | Sucrose |
| External link |
 http://pmn.plantcyc.org/ARA/NEW-IMAGE?type=COMPOUND&object=SUCROSE
|
| Mass information |
1st experiment : compound_URL_list_20130127_edit.txtLC-Q-TOF/MS (Negative ion mode), GC-TOF/MS 2nd experiment : compound_URL_list_20130127_edit.txtLC-Q-TOF/MS (Negative ion mode) |
| Molecular Formula | H22O11C12 |
| Canonical SMILES | C(O)C1(C(O)C(C(CO)O1)O)OC2(C(O)C(C(O)C(CO)O2)O) |
| Molecular Weight | 342.299 |
| Pathway Information | stachyose biosynthesis, fructan degradation, stachyose degradation, galactose degradation III, superpathway of sucrose and starch metabolism II (photosynthetic tissue), sucrose degradation III, UDP-glucose biosynthesis (from sucrose), ajugose biosynthesis II (galactinol-independent), sucrose biosynthesis I |
| CAS ID | 8027-47-2, 92004-84-7, 57-50-1 |
| Synonym | Glc(α1<->2β)Fru; sugar; saccharose; Glc(α1->2β)Fru; α-D-glucopyranosyl β-D-fructofuranoside |
| External ID | LIGAND:C00089, CHEBI:17992, PUBCHEM:5988, LIGAND-CPD:C00089, NCI:406942 |
information