| ID | C0141 |
| Compound name | Malic acid |
| Stereochemistry | D,L-Malic acid |
| Aracyc name | (RS)-Malate |
| External link |
|
| Mass information |
1st experiment : GC-TOF/MS 2nd experiment : GC-TOF/MS, CE-TOF/MS (Anion analysis) |
| Molecular Formula | H4C4O5 |
| Canonical SMILES | C(=O)([O-])CC(O)C([O-])=O |
| Molecular Weight | 134.088 |
| Pathway Information | sinapate ester biosynthesis, superpathway of glyoxylate cycle and fatty acid degradation, TCA cycle variation III (eukaryotic), glyoxylate cycle, aspartate degradation II, TCA cycle variation V (plant), gluconeogenesis I, glycolate and glyoxylate degradation II |
| CAS ID | 6915-15-7, 97-67-6 |
| Synonym | malate; L-malic acid; L-apple acid; (S)-malic acid; hydroxysuccinic acid; hydroxybutanedioic acid; malic acid; L-mal; mal; L-malate; (S)-malate; DL-malic acid |
| External ID | PUBCHEM:5459792, CHEBI:15589, LIGAND-CPD:C00149 |